Products 1030312-52-7

CAS 1030312-52-7 is the registry number for 2-(3-Oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetic acid (CAS 1030312-52-7) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: 2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetic acid. InChIKey: CVBURXPBIHMVKR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O3S
Molecular weight254.31 g/mol
IUPAC name2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetic acid
InChIKeyCVBURXPBIHMVKR-UHFFFAOYSA-N
SMILESC1CN(C(C(=O)N1)CC(=O)O)CC2=CC=CS2

Computed by PubChem (NCBI)