cas: 20940-75-4 — see every product listed under this CAS number, including other names
2-(3-methoxybenzyl)succinic acid, 95%, 95% (CAS 20940-75-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EZQ-100mg |
| cas | 20940-75-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2474.00 Pln | |
| Chemat | 250mg | 4888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(3-methoxyphenyl)methyl]butanedioic acid (CAS 20940-75-4) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 2-[(3-methoxyphenyl)methyl]butanedioic acid. InChIKey: FMZYGPLENOEZAC-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-[(3-methoxyphenyl)methyl]butanedioic acid |
| InChIKey | FMZYGPLENOEZAC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)