cas: 1046812-03-6 — see every product listed under this CAS number, including other names
2-(4,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1046812-03-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616727-250MG |
| cas | 1046812-03-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 1g | 1721.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1046812-03-6) is a chemical compound with the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. IUPAC name: 2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NVQMFAGDOWSMOK-UHFFFAOYSA-N.
| Molecular formula | C10H17BO3 |
|---|---|
| Molecular weight | 196.05 g/mol |
| IUPAC name | 2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NVQMFAGDOWSMOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COCC2 |
Computed by PubChem (NCBI)