cas: 1046812-03-6 — see every product listed under this CAS number, including other names
2-(4,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 1046812-03-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KI3-50mg |
| cas | 1046812-03-6 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 227.60 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1480.40 Pln | |
| Chemat | 5g | 4763.60 Pln | |
| Chemat | 10g | 8080.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1046812-03-6) is a chemical compound with the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. IUPAC name: 2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NVQMFAGDOWSMOK-UHFFFAOYSA-N.
| Molecular formula | C10H17BO3 |
|---|---|
| Molecular weight | 196.05 g/mol |
| IUPAC name | 2-(2,3-dihydrofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NVQMFAGDOWSMOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COCC2 |
Computed by PubChem (NCBI)