2-(4-(1,3-Dioxolan-2-yl)phenyl)-1,3,2-dioxaborolane, 95%
cas: 223555-54-2 — see every product listed under this CAS number, including other names
2-(4-(1,3-Dioxolan-2-yl)phenyl)-1,3,2-dioxaborolane, 95% (CAS 223555-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1721342-250mg |
| cas | 223555-54-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Ambeed | 5g | 4414.31 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 497.63 Pln | |
| BLDpharm | 1g | 1130.74 Pln | |
| BLDpharm | 5g | 4318.50 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 837.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane (CAS 223555-54-2) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane. InChIKey: JKEZKYGQVUNIGD-UHFFFAOYSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | JKEZKYGQVUNIGD-UHFFFAOYSA-N |
| SMILES | B1(OCCO1)C2=CC=C(C=C2)C3OCCO3 |
Computed by PubChem (NCBI)