CAS 2225181-61-1 is the registry number for (3–cyclopropyl–5–(methoxycarbonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(3-cyclopropyl-5-methoxycarbonylphenyl)boronic acid (CAS 2225181-61-1) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: (3-cyclopropyl-5-methoxycarbonylphenyl)boronic acid. InChIKey: YWZXWLOUDNQSDD-UHFFFAOYSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | (3-cyclopropyl-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | YWZXWLOUDNQSDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)OC)C2CC2)(O)O |
Computed by PubChem (NCBI)