2-(4-(2-Fluoroethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%
cas: 864754-47-2 — see every product listed under this CAS number, including other names
2-(4-(2-Fluoroethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 864754-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447780-100MG |
| cas | 864754-47-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln | |
| Fluorochem | 10g | 3413.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 864754-47-2) is a chemical compound with the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. IUPAC name: 2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RJQFPXYMWQGKNI-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RJQFPXYMWQGKNI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCF |
Computed by PubChem (NCBI)
Synonyms:
2-(4-(2-Fluoroethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-(2-Fluoroethoxy)phenylboronic acid, pinacol ester, 2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 1,3,2-Dioxaborolane, 2-[4-(2-fluoroethoxy)phenyl]-4,4,5,5-tetramethyl-, 2-[4-(2-Fluoro-ethoxy)-phenyl]-4,4,5,5-tetramethyl -[1,3,2]dioxaborolane