cas: 1072945-04-0 — see every product listed under this CAS number, including other names
2-(4-(Chloromethyl)Phenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane, 98%, 98% (CAS 1072945-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ESI-100mg |
| cas | 1072945-04-0 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1571.60 Pln | |
| Chemat | 25g | 5258.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1072945-04-0) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-[4-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BCRBYHCRLQCNNV-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-[4-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BCRBYHCRLQCNNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)