cas: 675605-92-2 — see every product listed under this CAS number, including other names
2-(4-(Methoxymethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 675605-92-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G2P7-1g |
| cas | 675605-92-2 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 675605-92-2) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 2-[4-(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AYKXQFSQDGLWAB-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-[4-(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AYKXQFSQDGLWAB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)COC |
Computed by PubChem (NCBI)