2-(4-(Trifluoromethoxy)benzamido)benzoic acid, 95%
cas: 1053976-41-2 — see every product listed under this CAS number, including other names
2-(4-(Trifluoromethoxy)benzamido)benzoic acid, 95% (CAS 1053976-41-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1539126-250mg |
| cas | 1053976-41-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| BLDpharm | 100mg | 397.66 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1014.11 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 981.20 Pln | |
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 726.85 Pln | |
| Fluorochem | 1g | 1809.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid (CAS 1053976-41-2) is a chemical compound with the molecular formula C15H10F3NO4 and a molecular weight of 325.24 g/mol. IUPAC name: 2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid. InChIKey: RYMWPJNGDKWFMN-UHFFFAOYSA-N.
| Molecular formula | C15H10F3NO4 |
|---|---|
| Molecular weight | 325.24 g/mol |
| IUPAC name | 2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid |
| InChIKey | RYMWPJNGDKWFMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)