Products 1053976-41-2
CAS 1053976-41-2 appears in our catalog under these names: 2-(4-(Trifluoromethoxy)benzamido)benzoic acid, 95%, 2-(4-(Trifluoromethoxy)benzamido)benzoic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid (CAS 1053976-41-2) is a chemical compound with the molecular formula C15H10F3NO4 and a molecular weight of 325.24 g/mol. IUPAC name: 2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid. InChIKey: RYMWPJNGDKWFMN-UHFFFAOYSA-N.
| Molecular formula | C15H10F3NO4 |
|---|---|
| Molecular weight | 325.24 g/mol |
| IUPAC name | 2-[[4-(trifluoromethoxy)benzoyl]amino]benzoic acid |
| InChIKey | RYMWPJNGDKWFMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)