CAS 903288-98-2 is the registry number for 1-(4-(2-Nitro-4-(trifluoromethyl)phenoxy)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 2g.
1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethanone (CAS 903288-98-2) is a chemical compound with the molecular formula C15H10F3NO4 and a molecular weight of 325.24 g/mol. IUPAC name: 1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethanone. InChIKey: VBLACFVBSWNRSL-UHFFFAOYSA-N.
| Molecular formula | C15H10F3NO4 |
|---|---|
| Molecular weight | 325.24 g/mol |
| IUPAC name | 1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethanone |
| InChIKey | VBLACFVBSWNRSL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)