CAS 2248286-24-8 is the registry number for 1,3-Dioxoisoindolin-2-yl 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate (CAS 2248286-24-8) is a chemical compound with the molecular formula C15H10F3NO4 and a molecular weight of 325.24 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate. InChIKey: WQORFLXFRIFKCI-UHFFFAOYSA-N.
| Molecular formula | C15H10F3NO4 |
|---|---|
| Molecular weight | 325.24 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | WQORFLXFRIFKCI-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(F)(F)F)C(=O)ON3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)