2-(4-(Trifluoromethoxy)phenoxy)acetic acid, 95%
cas: 72220-50-9 — see every product listed under this CAS number, including other names
2-(4-(Trifluoromethoxy)phenoxy)acetic acid, 95% (CAS 72220-50-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A261190-250mg |
| cas | 72220-50-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 503.88 Pln | |
| Ambeed | 25g | 1149.12 Pln | |
| Ambeed | 100g | 3524.31 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 386.56 Pln | |
| BLDpharm | 10g | 536.50 Pln | |
| BLDpharm | 25g | 1236.26 Pln | |
| BLDpharm | 100g | 3796.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[4-(trifluoromethoxy)phenoxy]acetic acid (CAS 72220-50-9) is a chemical compound with the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenoxy]acetic acid. InChIKey: QHSBEEUEIRDHCD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenoxy]acetic acid |
| InChIKey | QHSBEEUEIRDHCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2-(4-(Trifluoromethoxy)phenoxy)acetic acid, 4-(Trifluoromethoxy)phenoxyacetic acid, 2-[4-(trifluoromethoxy)phenoxy]acetic acid, [4-(trifluoromethoxy)phenoxy]acetic acid, (4-trifluoromethoxy-phenoxy)-acetic acid, Acetic acid, [4-(trifluoromethoxy)phenoxy]-, Acetic acid, 2-[4-(trifluoromethoxy)phenoxy]-, Maybridge1_006105, Acetic acid, [4-(trifluo, 4-trifluoromethoxyphenoxyacetic acid