CAS 191604-88-3 is the registry number for 2-Methoxy-5-(trifluoromethoxy)benzoic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
2-methoxy-5-(trifluoromethoxy)benzoic acid (CAS 191604-88-3) is a chemical compound with the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethoxy)benzoic acid. InChIKey: HURBWIHJHDFCGU-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethoxy)benzoic acid |
| InChIKey | HURBWIHJHDFCGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)