Products 191604-88-3

CAS 191604-88-3 is the registry number for 2-Methoxy-5-(trifluoromethoxy)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-methoxy-5-(trifluoromethoxy)benzoic acid (CAS 191604-88-3) is a chemical compound with the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethoxy)benzoic acid. InChIKey: HURBWIHJHDFCGU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O4
Molecular weight236.14 g/mol
IUPAC name2-methoxy-5-(trifluoromethoxy)benzoic acid
InChIKeyHURBWIHJHDFCGU-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)OC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)