Products 1261746-64-8
CAS 1261746-64-8 is the registry number for Methyl 4-hydroxy-3-(trifluoromethoxy)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-hydroxy-3-(trifluoromethoxy)benzoate (CAS 1261746-64-8) is a chemical compound with the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. IUPAC name: methyl 4-hydroxy-3-(trifluoromethoxy)benzoate. InChIKey: DXSRZGRDEIGJIE-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | methyl 4-hydroxy-3-(trifluoromethoxy)benzoate |
| InChIKey | DXSRZGRDEIGJIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)OC(F)(F)F |
Computed by PubChem (NCBI)