CAS 1221723-99-4 appears in our catalog under these names: 3-Hydroxy-5-(2,2,2-trifluoroethoxy)benzoic acid, 95%, 3-Hydroxy-5-(2,2,2-trifluoroethoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-hydroxy-5-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1221723-99-4) is a chemical compound with the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. IUPAC name: 3-hydroxy-5-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: CNCAOTMTYQULPP-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O4 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 3-hydroxy-5-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | CNCAOTMTYQULPP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)