cas: 84102-58-9 — see every product listed under this CAS number, including other names
2-(4-Aminophenyl)benzofuran-5-amine 98% (CAS 84102-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461393-100mg |
| cas | 84102-58-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 526.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A461393 |
2-(4-aminophenyl)-1-benzofuran-5-amine (CAS 84102-58-9) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-(4-aminophenyl)-1-benzofuran-5-amine. InChIKey: FKMCNLLISWDXJQ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1-benzofuran-5-amine |
| InChIKey | FKMCNLLISWDXJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(O2)C=CC(=C3)N)N |
Computed by PubChem (NCBI)