cas: 2622-74-4 — see every product listed under this CAS number, including other names
2-(4-BROMOPHENYL)BENZOIMIDAZOLE, 96% (CAS 2622-74-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302634-1G |
| cas | 2622-74-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 841.39 Pln | |
| Fluorochem | 25g | 1419.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromophenyl)-1H-benzimidazole (CAS 2622-74-4) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-(4-bromophenyl)-1H-benzimidazole. InChIKey: YRWMGOSKROWAIT-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1H-benzimidazole |
| InChIKey | YRWMGOSKROWAIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)