cas: 2622-74-4 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)-1H-benzo[d]imidazole, 96%, 96% (CAS 2622-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SC6-100mg |
| cas | 2622-74-4 |
| size | 100mg |
| availability | 105g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 25g | 870.80 Pln | |
| Chemat | 100g | 2584.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-1H-benzimidazole (CAS 2622-74-4) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-(4-bromophenyl)-1H-benzimidazole. InChIKey: YRWMGOSKROWAIT-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1H-benzimidazole |
| InChIKey | YRWMGOSKROWAIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)