CAS 1072945-84-6 appears in our catalog under these names: 4-(Carboxymethoxy)phenylboronic acid, 97%, 2-(4-Boronophenoxy)acetic acid, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-(4-boronophenoxy)acetic acid (CAS 1072945-84-6) is a chemical compound with the molecular formula C8H9BO5 and a molecular weight of 195.97 g/mol. IUPAC name: 2-(4-boronophenoxy)acetic acid. InChIKey: RJTGNLGIQQFSEI-UHFFFAOYSA-N.
| Molecular formula | C8H9BO5 |
|---|---|
| Molecular weight | 195.97 g/mol |
| IUPAC name | 2-(4-boronophenoxy)acetic acid |
| InChIKey | RJTGNLGIQQFSEI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC(=O)O)(O)O |
Computed by PubChem (NCBI)