CAS 1229442-38-9 is the registry number for (2-Hydroxy-5-(methoxycarbonyl)phenyl)boronic acid 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-hydroxy-5-methoxycarbonylphenyl)boronic acid (CAS 1229442-38-9) is a chemical compound with the molecular formula C8H9BO5 and a molecular weight of 195.97 g/mol. IUPAC name: (2-hydroxy-5-methoxycarbonylphenyl)boronic acid. InChIKey: VRDWPZWBZVUPEB-UHFFFAOYSA-N.
| Molecular formula | C8H9BO5 |
|---|---|
| Molecular weight | 195.97 g/mol |
| IUPAC name | (2-hydroxy-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | VRDWPZWBZVUPEB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OC)O)(O)O |
Computed by PubChem (NCBI)