Products 741699-09-2
CAS 741699-09-2 appears in our catalog under these names: 4-Carboxy-2-methoxyphenylboronic acid, 96%, 4-Borono-3-methoxybenzoic acid 95%, 4-Borono-3-methoxybenzoic acid, 95%, 95%, 4-Borono-3-methoxybenzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-borono-3-methoxybenzoic acid (CAS 741699-09-2) is a chemical compound with the molecular formula C8H9BO5 and a molecular weight of 195.97 g/mol. IUPAC name: 4-borono-3-methoxybenzoic acid. InChIKey: ITWXOEQLYFYTJX-UHFFFAOYSA-N.
| Molecular formula | C8H9BO5 |
|---|---|
| Molecular weight | 195.97 g/mol |
| IUPAC name | 4-borono-3-methoxybenzoic acid |
| InChIKey | ITWXOEQLYFYTJX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)O)OC)(O)O |
Computed by PubChem (NCBI)