CAS 851335-12-1 appears in our catalog under these names: 3–Methoxy–4–carboxyphenylboronic acid, 3-Methoxy-4-carboxyphenylboronic acid 98%, 3-Methoxy-4-carboxyphenylboronic acid, 98%, 98%, 3-Methoxy-4-carboxyphenylboronic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-borono-2-methoxybenzoic acid (CAS 851335-12-1) is a chemical compound with the molecular formula C8H9BO5 and a molecular weight of 195.97 g/mol. IUPAC name: 4-borono-2-methoxybenzoic acid. InChIKey: ASOXJGFTNRPKEN-UHFFFAOYSA-N.
| Molecular formula | C8H9BO5 |
|---|---|
| Molecular weight | 195.97 g/mol |
| IUPAC name | 4-borono-2-methoxybenzoic acid |
| InChIKey | ASOXJGFTNRPKEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)O)OC)(O)O |
Computed by PubChem (NCBI)