cas: 857641-46-4 — see every product listed under this CAS number, including other names
2-(4-Bromo-1H-pyrazol-1-yl)pyrimidine, 95% (CAS 857641-46-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A125639-10g |
| cas | 857641-46-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6202.42 Pln | |
| Fluorochem | 50mg | 284.29 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 706.02 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-bromopyrazol-1-yl)pyrimidine (CAS 857641-46-4) is a chemical compound with the molecular formula C7H5BrN4 and a molecular weight of 225.05 g/mol. IUPAC name: 2-(4-bromopyrazol-1-yl)pyrimidine. InChIKey: OLHCXNGGKICQLL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4 |
|---|---|
| Molecular weight | 225.05 g/mol |
| IUPAC name | 2-(4-bromopyrazol-1-yl)pyrimidine |
| InChIKey | OLHCXNGGKICQLL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)