CAS 219508-87-9 is the registry number for 2-(3-Bromo-1h-1,2,4-triazol-5-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(5-bromo-1H-1,2,4-triazol-3-yl)pyridine (CAS 219508-87-9) is a chemical compound with the molecular formula C7H5BrN4 and a molecular weight of 225.05 g/mol. IUPAC name: 2-(5-bromo-1H-1,2,4-triazol-3-yl)pyridine. InChIKey: RJIVYLRDPMZJGI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4 |
|---|---|
| Molecular weight | 225.05 g/mol |
| IUPAC name | 2-(5-bromo-1H-1,2,4-triazol-3-yl)pyridine |
| InChIKey | RJIVYLRDPMZJGI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NNC(=N2)Br |
Computed by PubChem (NCBI)