CAS 65697-41-8 is the registry number for 1-(3-Bromophenyl)-1h-1,2,3,4-tetrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(3-bromophenyl)tetrazole (CAS 65697-41-8) is a chemical compound with the molecular formula C7H5BrN4 and a molecular weight of 225.05 g/mol. IUPAC name: 1-(3-bromophenyl)tetrazole. InChIKey: CRCFDMMRNPZPJY-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4 |
|---|---|
| Molecular weight | 225.05 g/mol |
| IUPAC name | 1-(3-bromophenyl)tetrazole |
| InChIKey | CRCFDMMRNPZPJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=NN=N2 |
Computed by PubChem (NCBI)