CAS 91225-51-3 is the registry number for 2-Bromo-6-methylpyrazino[2,3-b]pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-bromo-6-methylpyrazino[2,3-b]pyrazine (CAS 91225-51-3) is a chemical compound with the molecular formula C7H5BrN4 and a molecular weight of 225.05 g/mol. IUPAC name: 2-bromo-6-methylpyrazino[2,3-b]pyrazine. InChIKey: GIVAQAIJCWLXQM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4 |
|---|---|
| Molecular weight | 225.05 g/mol |
| IUPAC name | 2-bromo-6-methylpyrazino[2,3-b]pyrazine |
| InChIKey | GIVAQAIJCWLXQM-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=N1)N=CC(=N2)Br |
Computed by PubChem (NCBI)