CAS 186748-46-9 appears in our catalog under these names: 2-(4-Bromo-2,6-dimethylphenyl)acetic acid, 2-(4-Bromo-2,6-dimethylphenyl)acetic acid, 98%, 98%, 4-BROMO-2,6-DIMETHYLPHENYLACETIC ACID, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g, 100mg, 250mg, 10g.
2-(4-bromo-2,6-dimethylphenyl)acetic acid (CAS 186748-46-9) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(4-bromo-2,6-dimethylphenyl)acetic acid. InChIKey: ARQKHJYNMJGZET-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(4-bromo-2,6-dimethylphenyl)acetic acid |
| InChIKey | ARQKHJYNMJGZET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC(=O)O)C)Br |
Computed by PubChem (NCBI)