CAS 359629-91-7 appears in our catalog under these names: Ethyl 5-bromo-2-methylbenzoate, 95%, 5-Bromo-2-methylbenzoic acid ethyl ester, Ethyl 5-bromo-2-methylbenzoate, 98%, 98%, Ethyl 5-bromo-2-methylbenzoate, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2g, 100mg, 250mg.
Ethyl 5-bromo-2-methylbenzoate (CAS 359629-91-7) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: ethyl 5-bromo-2-methylbenzoate. InChIKey: NHMJLUHCYZHKMO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | ethyl 5-bromo-2-methylbenzoate |
| InChIKey | NHMJLUHCYZHKMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)C |
Computed by PubChem (NCBI)