CAS 52113-69-6 appears in our catalog under these names: 6-Bromo-2,2-dimethyl-2,4-dihydro-1,3-benzodioxine, 95%, 6-Bromo-2,2-dimethyl-4H-benzo(d)(1,3)dioxine, 98%, 6-Bromo-2,2-dimethyl-2,4-dihydro-1,3-benzodioxine, 6-Bromo-2,2-dimethyl-2,4-dihydro-1,3-benzodioxine, 99%, 99%, 6-BROMO-2,2-DIMETHYL-4H-BENZO[D][1,3]DIOXINE, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2,5g, 100mg.
6-bromo-2,2-dimethyl-4H-1,3-benzodioxine (CAS 52113-69-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-4H-1,3-benzodioxine. InChIKey: UIALGZOSKLCMHF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-4H-1,3-benzodioxine |
| InChIKey | UIALGZOSKLCMHF-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)