CAS 741698-94-2 appears in our catalog under these names: 4-Bromo-3-isopropylbenzoic acid, 98%, 4-Bromo-3-isopropylbenzoic acid 95%, 4-Bromo-3-isopropylbenzoic acid, 95%, 95%, 4-Bromo-3-isopropylbenzoic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100g, 100mg, 25g.
4-bromo-3-propan-2-ylbenzoic acid (CAS 741698-94-2) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 4-bromo-3-propan-2-ylbenzoic acid. InChIKey: AVLGNLUCRVKPGU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 4-bromo-3-propan-2-ylbenzoic acid |
| InChIKey | AVLGNLUCRVKPGU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)