cas: 1326316-85-1 — see every product listed under this CAS number, including other names
2-(4-Bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1326316-85-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691562-1G |
| cas | 1326316-85-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 825.77 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1326316-85-1) is a chemical compound with the molecular formula C12H15BBrFO2 and a molecular weight of 300.96 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YCGVIJBHBZUTTM-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrFO2 |
|---|---|
| Molecular weight | 300.96 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YCGVIJBHBZUTTM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)