CAS 673456-16-1 is the registry number for 2-Bromomethyl-4-fluorophenylboronic acid, neopentyl glycol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[2-(bromomethyl)-4-fluorophenyl]-5,5-dimethyl-1,3,2-dioxaborinane (CAS 673456-16-1) is a chemical compound with the molecular formula C12H15BBrFO2 and a molecular weight of 300.96 g/mol. IUPAC name: 2-[2-(bromomethyl)-4-fluorophenyl]-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: DQRRGFNBYBOFHI-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrFO2 |
|---|---|
| Molecular weight | 300.96 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-4-fluorophenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | DQRRGFNBYBOFHI-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2)F)CBr |
Computed by PubChem (NCBI)