CAS 1326316-85-1 appears in our catalog under these names: 4-Bromo-2-fluorophenylboronic acid pinacol ester, 96%, 4–Bromo–2–fluorophenylboronic Acid Pinacol Ester, 4-Bromo-2-fluorophenylboronic Acid Pinacol Ester, 97%, 97%, 2-(4-Bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-(4-Bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1326316-85-1) is a chemical compound with the molecular formula C12H15BBrFO2 and a molecular weight of 300.96 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YCGVIJBHBZUTTM-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrFO2 |
|---|---|
| Molecular weight | 300.96 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YCGVIJBHBZUTTM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)