Products 1451391-19-7
CAS 1451391-19-7 appears in our catalog under these names: 2-(4-Bromo-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(4-Bromo-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 4-Bromo-3-fluorophenylboronic acid pinacol ester, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
2-(4-bromo-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1451391-19-7) is a chemical compound with the molecular formula C12H15BBrFO2 and a molecular weight of 300.96 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CVLFCLUICLFWPG-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrFO2 |
|---|---|
| Molecular weight | 300.96 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CVLFCLUICLFWPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)