cas: 148672-44-0 — see every product listed under this CAS number, including other names
2-(4-Bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole 95% (CAS 148672-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A992705-100mg |
| cas | 148672-44-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 854.31 Pln | |
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 1g | 2951.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A992705 |
2-(4-bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole (CAS 148672-44-0) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: DKPNWDYEHCWNTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | DKPNWDYEHCWNTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NN=C(O2)C)Br |
Computed by PubChem (NCBI)