CAS 1956327-21-1 is the registry number for 5-Bromo-3-ethylimidazo[1,2-a]pyridine-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-3-ethylimidazo[1,2-a]pyridine-2-carbaldehyde (CAS 1956327-21-1) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 5-bromo-3-ethylimidazo[1,2-a]pyridine-2-carbaldehyde. InChIKey: QNNNWTWKZQHIHY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 5-bromo-3-ethylimidazo[1,2-a]pyridine-2-carbaldehyde |
| InChIKey | QNNNWTWKZQHIHY-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C2N1C(=CC=C2)Br)C=O |
Computed by PubChem (NCBI)