CAS 148672-44-0 appears in our catalog under these names: 2-(4-Bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole, 95%, 2–(4–bromo–3–methylphenyl)–5–methyl–1,3,4–oxadiazole. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2-(4-bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole (CAS 148672-44-0) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: DKPNWDYEHCWNTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | DKPNWDYEHCWNTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NN=C(O2)C)Br |
Computed by PubChem (NCBI)