Products 1503919-39-8
CAS 1503919-39-8 is the registry number for 3-Amino-5-bromo-n-(prop-2-yn-1-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-amino-5-bromo-N-prop-2-ynylbenzamide (CAS 1503919-39-8) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 3-amino-5-bromo-N-prop-2-ynylbenzamide. InChIKey: XGWNBDJAJVTJMS-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 3-amino-5-bromo-N-prop-2-ynylbenzamide |
| InChIKey | XGWNBDJAJVTJMS-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC(=CC(=C1)Br)N |
Computed by PubChem (NCBI)