cas: 215949-57-8 — see every product listed under this CAS number, including other names
2-(4-Bromo-3-methylphenyl)acetic acid 98% (CAS 215949-57-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100889-250mg |
| cas | 215949-57-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 453.81 Pln | |
| Ambeed | 10g | 743.06 Pln | |
| Ambeed | 25g | 1588.56 Pln | |
| Ambeed | 100g | 5037.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100889 |
2-(4-bromo-3-methylphenyl)acetic acid (CAS 215949-57-8) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)acetic acid. InChIKey: LHFFNLRLDVODNC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)acetic acid |
| InChIKey | LHFFNLRLDVODNC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(=O)O)Br |
Computed by PubChem (NCBI)