cas: 83636-46-8 — see every product listed under this CAS number, including other names
2-(4-Bromo-Phenyl)-Propionic Acid Methyl Ester, 95%, 95% (CAS 83636-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G9UQ-100mg |
| cas | 83636-46-8 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1187.60 Pln | |
| Chemat | 5g | 3443.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4-bromophenyl)propanoate (CAS 83636-46-8) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 2-(4-bromophenyl)propanoate. InChIKey: KZWKRXZFJWFHSR-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)propanoate |
| InChIKey | KZWKRXZFJWFHSR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)