cas: 1187930-57-9 — see every product listed under this CAS number, including other names
2-(4-Bromo-phenyl)-pyrrolidine hydrochloride, 96% (CAS 1187930-57-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F736971-250MG |
| cas | 1187930-57-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 5g | 1939.96 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromophenyl)pyrrolidine;hydrochloride (CAS 1187930-57-9) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 2-(4-bromophenyl)pyrrolidine;hydrochloride. InChIKey: MFKFCHQDGBJUIU-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 2-(4-bromophenyl)pyrrolidine;hydrochloride |
| InChIKey | MFKFCHQDGBJUIU-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)