cas: 1025719-11-2 — see every product listed under this CAS number, including other names
2-(4-Bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96% (CAS 1025719-11-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A138166-25g |
| cas | 1025719-11-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 29690.50 Pln | |
| AmBeed | 5g | 12764.50 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1025719-11-2) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: 2-(4-bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HIXOLIOBXRCIBC-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | 2-(4-bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HIXOLIOBXRCIBC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CO2)Br |
Computed by PubChem (NCBI)