Products 1111096-25-3
CAS 1111096-25-3 appears in our catalog under these names: 2-(5-Bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 5–Bromofuran–2–boronic acid pinacol ester. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 25mg, 5mg.
2-(5-bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1111096-25-3) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: 2-(5-bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UQPIQWGQNJWGTE-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | 2-(5-bromofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UQPIQWGQNJWGTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)