cas: 32454-35-6 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)-2-methylpropanoic acid, 97%, 97% (CAS 32454-35-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I76E-100mg |
| cas | 32454-35-6 |
| size | 100mg |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 251.60 Pln | |
| Chemat | 50g | 405.20 Pln | |
| Chemat | 100g | 683.60 Pln | |
| Chemat | 250g | 1302.80 Pln | |
| Chemat | 500g | 2198.40 Pln | |
| Chemat | 1kg | 3971.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-2-methylpropanoic acid (CAS 32454-35-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(4-bromophenyl)-2-methylpropanoic acid. InChIKey: AKVOQXBQLXOEEF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-methylpropanoic acid |
| InChIKey | AKVOQXBQLXOEEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)