2-(4-Bromophenyl)-2-oxoethyl acetate, 97%
cas: 7500-37-0 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)-2-oxoethyl acetate, 97% (CAS 7500-37-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F241330-1G |
| cas | 7500-37-0 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 747.67 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 731.94 Pln | |
| Ambeed | 10g | 1210.31 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 25g | 2392.40 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 780.86 Pln | |
| BLDpharm | 10g | 1302.90 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
[2-(4-bromophenyl)-2-oxoethyl] acetate (CAS 7500-37-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: [2-(4-bromophenyl)-2-oxoethyl] acetate. InChIKey: DYDDLQHJYMWTMU-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | [2-(4-bromophenyl)-2-oxoethyl] acetate |
| InChIKey | DYDDLQHJYMWTMU-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)