CAS 99199-54-9 appears in our catalog under these names: 6-Bromochromane-2-carboxylic acid, 96%, 6–Bromochroman–2–carboxylic acid, 6-Bromochromane-2-carboxylic acid, 97%, 97%, 6-BROMOCHROMAN-2-CARBOXYLIC ACID, 98%, 6-Bromochroman-2-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
6-bromo-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 99199-54-9) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 6-bromo-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: LDOBEICKZURYCC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | LDOBEICKZURYCC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)OC1C(=O)O |
Computed by PubChem (NCBI)