CAS 7500-37-0 appears in our catalog under these names: 2-(4-Bromophenyl)-2-oxoethyl acetate, 95%, 2-(4-Bromophenyl)-2-oxoethyl acetate 97%, 2-(4-Bromophenyl)-2-oxoethyl acetate, 97%, 97%, 2-(4-Bromophenyl)-2-oxoethyl acetate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g.
[2-(4-bromophenyl)-2-oxoethyl] acetate (CAS 7500-37-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: [2-(4-bromophenyl)-2-oxoethyl] acetate. InChIKey: DYDDLQHJYMWTMU-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | [2-(4-bromophenyl)-2-oxoethyl] acetate |
| InChIKey | DYDDLQHJYMWTMU-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)