CAS 924271-33-0 appears in our catalog under these names: 4-Bromo-3-methoxycinnamic acid, 95%, 3-(4-Bromo-3-methoxyphenyl)acrylic acid, 97%, (e)-3-(4-Bromo-3-methoxyphenyl)acrylic acid, 97%, 97%, 4-BROMO-3-METHOXYCINNAMIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 100mg.
(E)-3-(4-bromo-3-methoxyphenyl)prop-2-enoic acid (CAS 924271-33-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: (E)-3-(4-bromo-3-methoxyphenyl)prop-2-enoic acid. InChIKey: NZBZIWVGKOEFAF-HWKANZROSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | (E)-3-(4-bromo-3-methoxyphenyl)prop-2-enoic acid |
| InChIKey | NZBZIWVGKOEFAF-HWKANZROSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)